C36H50N4O6 — CID 158905785
6-[6-(6-amino-6-iminohexoxy)-1-hydroxy-7-(hydroxymethyl)-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyhexanimidamide (PubChem CID 158905785) has the molecular formula C36H50N4O6 and a molecular weight of 634.82 g/mol. Its IUPAC name is 6-[6-(6-amino-6-iminohexoxy)-1-hydroxy-7-(hydroxymethyl)-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyhexanimidamide.
| Compound Name | 6-[6-(6-amino-6-iminohexoxy)-1-hydroxy-7-(hydroxymethyl)-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyhexanimidamide |
|---|---|
| PubChem CID | 158905785 |
| Molecular Formula | C36H50N4O6 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.37 |
| IUPAC Name | 6-[6-(6-amino-6-iminohexoxy)-1-hydroxy-7-(hydroxymethyl)-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyhexanimidamide |
| SMILES | [H]/N=C(\N)CCCCCOc1cc2oc3cc(OCCCCC/C(N)=N/[H])c(CO)c(CC=C(C)C)c3c(=O)c2c(O)c1CC=C(C)C |
| InChI | InChI=1S/C36H50N4O6/c1-22(2)13-15-24-26(21-41)28(45-18-10-6-8-12-32(39)40)20-29-33(24)36(43)34-30(46-29)19-27(25(35(34)42)16-14-23(3)4)44-17-9-5-7-11-31(37)38/h13-14,19-20,41-42H,5-12,15-18,21H2,1-4H3,(H3,37,38)(H3,39,40) |
| InChIKey | JGAJAWUQFRBJPN-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 188.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|