C24H29FN2O6 — CID 158906303
2-fluoro-N-[3,4,5-trimethoxy-2-(4-morpholin-4-ylbutanoyl)phenyl]benzamide (PubChem CID 158906303) has the molecular formula C24H29FN2O6 and a molecular weight of 460.50 g/mol. Its IUPAC name is 2-fluoro-N-[3,4,5-trimethoxy-2-(4-morpholin-4-ylbutanoyl)phenyl]benzamide.
| Compound Name | 2-fluoro-N-[3,4,5-trimethoxy-2-(4-morpholin-4-ylbutanoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 158906303 |
| Molecular Formula | C24H29FN2O6 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 2-fluoro-N-[3,4,5-trimethoxy-2-(4-morpholin-4-ylbutanoyl)phenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2F)c(C(=O)CCCN2CCOCC2)c(OC)c1OC |
| InChI | InChI=1S/C24H29FN2O6/c1-30-20-15-18(26-24(29)16-7-4-5-8-17(16)25)21(23(32-3)22(20)31-2)19(28)9-6-10-27-11-13-33-14-12-27/h4-5,7-8,15H,6,9-14H2,1-3H3,(H,26,29) |
| InChIKey | JGBXAFOXSSAIFU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |