C41H70 — CID 158906766
bis(1,3,5,7-tetramethyladamantane);1,3,5-trimethyladamantane (PubChem CID 158906766) has the molecular formula C41H70 and a molecular weight of 563.01 g/mol. Its IUPAC name is bis(1,3,5,7-tetramethyladamantane);1,3,5-trimethyladamantane.
| Compound Name | bis(1,3,5,7-tetramethyladamantane);1,3,5-trimethyladamantane |
|---|---|
| PubChem CID | 158906766 |
| Molecular Formula | C41H70 |
| Molecular Weight | 563.01 g/mol |
| Exact Mass | 562.55 |
| IUPAC Name | bis(1,3,5,7-tetramethyladamantane);1,3,5-trimethyladamantane |
| SMILES | CC12CC3(C)CC(C)(C1)CC(C)(C2)C3.CC12CC3(C)CC(C)(C1)CC(C)(C2)C3.CC12CC3CC(C)(C1)CC(C)(C3)C2 |
| InChI | InChI=1S/2C14H24.C13H22/c2*1-11-5-12(2)8-13(3,6-11)10-14(4,7-11)9-12;1-11-4-10-5-12(2,7-11)9-13(3,6-10)8-11/h2*5-10H2,1-4H3;10H,4-9H2,1-3H3 |
| InChIKey | JGDILFKJNSJDMW-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.01 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |