About [[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene
[[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene (PubChem CID 158907606) has the molecular formula C13H16N2O3S
and a molecular weight of 280.35 g/mol. Its IUPAC name is [[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene.
Molecular Properties
| Compound Name | [[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene |
| PubChem CID | 158907606 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | [[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene |
| SMILES | C=C.Cc1cc(C)cc(C(C#N)=NOS(C)(=O)=O)c1 |
| InChI | InChI=1S/C11H12N2O3S.C2H4/c1-8-4-9(2)6-10(5-8)11(7-12)13-16-17(3,14)15;1-2/h4-6H,1-3H3;1-2H2 |
| InChIKey | JGFYAENDRPRWPI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 79.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene?
The IUPAC name of [[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene (CID 158907606) is [[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene.
What is the SMILES notation for [[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene?
The canonical SMILES for [[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene is C=C.Cc1cc(C)cc(C(C#N)=NOS(C)(=O)=O)c1.
What is the InChIKey of [[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene?
The InChIKey is JGFYAENDRPRWPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3S.C2H4/c1-8-4-9(2)6-10(5-8)11(7-12)13-16-17(3,14)15;1-2/h4-6H,1-3H3;1-2H2.
What are the key properties of [[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene?
[[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene has a molecular weight of 280.35 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[cyano-(3,5-dimethylphenyl)methylidene]amino] methanesulfonate;ethene is sourced from PubChem (CID 158907606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).