C19H25NO4 — CID 15890915
ethyl (E)-2-methyl-4-[3-oxobutanoyl-[(1S)-1-phenylethyl]amino]but-2-enoate (PubChem CID 15890915) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is ethyl (E)-2-methyl-4-[3-oxobutanoyl-[(1S)-1-phenylethyl]amino]but-2-enoate.
| Compound Name | ethyl (E)-2-methyl-4-[3-oxobutanoyl-[(1S)-1-phenylethyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 15890915 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | ethyl (E)-2-methyl-4-[3-oxobutanoyl-[(1S)-1-phenylethyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/CN(C(=O)CC(C)=O)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H25NO4/c1-5-24-19(23)14(2)11-12-20(18(22)13-15(3)21)16(4)17-9-7-6-8-10-17/h6-11,16H,5,12-13H2,1-4H3/b14-11+/t16-/m0/s1 |
| InChIKey | STKIEZRSSYQZTB-UKYUDJEDSA-N |
| XLogP | 3.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|