C22H24ClN3O3S — CID 158909535
[4-chloro-3-[(2S,4R)-4-hydroxy-2-[3-(4-methylphenyl)propanoyl]pyrrolidine-1-carbonyl]phenyl]thiourea (PubChem CID 158909535) has the molecular formula C22H24ClN3O3S and a molecular weight of 445.97 g/mol. Its IUPAC name is [4-chloro-3-[(2S,4R)-4-hydroxy-2-[3-(4-methylphenyl)propanoyl]pyrrolidine-1-carbonyl]phenyl]thiourea.
| Compound Name | [4-chloro-3-[(2S,4R)-4-hydroxy-2-[3-(4-methylphenyl)propanoyl]pyrrolidine-1-carbonyl]phenyl]thiourea |
|---|---|
| PubChem CID | 158909535 |
| Molecular Formula | C22H24ClN3O3S |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | [4-chloro-3-[(2S,4R)-4-hydroxy-2-[3-(4-methylphenyl)propanoyl]pyrrolidine-1-carbonyl]phenyl]thiourea |
| SMILES | Cc1ccc(CCC(=O)[C@@H]2C[C@@H](O)CN2C(=O)c2cc(NC(N)=S)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H24ClN3O3S/c1-13-2-4-14(5-3-13)6-9-20(28)19-11-16(27)12-26(19)21(29)17-10-15(25-22(24)30)7-8-18(17)23/h2-5,7-8,10,16,19,27H,6,9,11-12H2,1H3,(H3,24,25,30)/t16-,19+/m1/s1 |
| InChIKey | UYIXQJRBQSDSCF-APWZRJJASA-N |
| XLogP | 3.08 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|