About CID 158909603
CID 158909603 (PubChem CID 158909603) has the molecular formula C48H45BiSi4
and a molecular weight of 943.21 g/mol.
Molecular Properties
| Compound Name | CID 158909603 |
| PubChem CID | 158909603 |
| Molecular Formula | C48H45BiSi4 |
| Molecular Weight | 943.21 g/mol |
| Exact Mass | 942.24 |
| IUPAC Name | — |
| SMILES | [BiH2].[SiH2][SiH3].c1ccc([Si](c2ccccc2)(c2ccccc2)c2ccc(-c3ccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H38Si2.Bi.H5Si2.2H/c1-7-19-41(20-8-1)49(42-21-9-2-10-22-42,43-23-11-3-12-24-43)47-35-31-39(32-36-47)40-33-37-48(38-34-40)50(44-25-13-4-14-26-44,45-27-15-5-16-28-45)46-29-17-6-18-30-46;;1-2;;/h1-38H;;1H2,2H3;; |
| InChIKey | JGLZZCOKESHHJA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 943.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 158909603 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158909603?
The IUPAC name of CID 158909603 (CID 158909603) is not available.
What is the SMILES notation for CID 158909603?
The canonical SMILES for CID 158909603 is [BiH2].[SiH2][SiH3].c1ccc([Si](c2ccccc2)(c2ccccc2)c2ccc(-c3ccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)cc2)cc1.
What is the InChIKey of CID 158909603?
The InChIKey is JGLZZCOKESHHJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H38Si2.Bi.H5Si2.2H/c1-7-19-41(20-8-1)49(42-21-9-2-10-22-42,43-23-11-3-12-24-43)47-35-31-39(32-36-47)40-33-37-48(38-34-40)50(44-25-13-4-14-26-44,45-27-15-5-16-28-45)46-29-17-6-18-30-46;;1-2;;/h1-38H;;1H2,2H3;;.
What are the key properties of CID 158909603?
CID 158909603 has a molecular weight of 943.21 g/mol, XLogP of 3.09, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158909603 is sourced from PubChem (CID 158909603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).