C19H17N3 — CID 158910339
3-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-indole] (PubChem CID 158910339) has the molecular formula C19H17N3 and a molecular weight of 287.37 g/mol. Its IUPAC name is 3-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-indole].
| Compound Name | 3-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-indole] |
|---|---|
| PubChem CID | 158910339 |
| Molecular Formula | C19H17N3 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 3-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-indole] |
| SMILES | CC1Cc2c([nH]c3ccccc23)C2(C=Nc3ccccc32)N1 |
| InChI | InChI=1S/C19H17N3/c1-12-10-14-13-6-2-4-8-16(13)21-18(14)19(22-12)11-20-17-9-5-3-7-15(17)19/h2-9,11-12,21-22H,10H2,1H3 |
| InChIKey | JGOJYSZIOPUCHI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |