C27H42O4Si — CID 158910749
(1S,6S,10R,11R,12S,13S,14R,16R)-12-[tert-butyl(dimethyl)silyl]oxy-1,11,15,15-tetramethyl-4-methylidene-7,9-dioxapentacyclo[11.5.0.02,6.06,10.014,16]octadec-2-en-8-one (PubChem CID 158910749) has the molecular formula C27H42O4Si and a molecular weight of 458.72 g/mol. Its IUPAC name is (1S,6S,10R,11R,12S,13S,14R,16R)-12-[tert-butyl(dimethyl)silyl]oxy-1,11,15,15-tetramethyl-4-methylidene-7,9-dioxapentacyclo[11.5.0.02,6.06,10.014,16]octadec-2-en-8-one.
| Compound Name | (1S,6S,10R,11R,12S,13S,14R,16R)-12-[tert-butyl(dimethyl)silyl]oxy-1,11,15,15-tetramethyl-4-methylidene-7,9-dioxapentacyclo[11.5.0.02,6.06,10.014,16]octadec-2-en-8-one |
|---|---|
| PubChem CID | 158910749 |
| Molecular Formula | C27H42O4Si |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | (1S,6S,10R,11R,12S,13S,14R,16R)-12-[tert-butyl(dimethyl)silyl]oxy-1,11,15,15-tetramethyl-4-methylidene-7,9-dioxapentacyclo[11.5.0.02,6.06,10.014,16]octadec-2-en-8-one |
| SMILES | C=C1C=C2[C@]3(C1)OC(=O)O[C@@H]3[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1[C@H]3[C@@H](CC[C@]21C)C3(C)C |
| InChI | InChI=1S/C27H42O4Si/c1-15-13-18-26(8)12-11-17-19(25(17,6)7)20(26)21(31-32(9,10)24(3,4)5)16(2)22-27(18,14-15)30-23(28)29-22/h13,16-17,19-22H,1,11-12,14H2,2-10H3/t16-,17+,19+,20+,21+,22+,26+,27-/m0/s1 |
| InChIKey | ZCOXJHBUNHLRDW-CJDDSYOOSA-N |
| XLogP | 6.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|