C18H31BrNO4P — CID 158910802
[(2S)-5-bromo-2-[(2S,3S,5R)-3-methyl-5-tritiooxolan-2-yl]pentyl]-[(2R,3S,5R)-2-(deuteriomethyl)-5-tritiooxolan-3-yl]oxy-(2-isocyanoethoxy)phosphane (PubChem CID 158910802) has the molecular formula C18H31BrNO4P and a molecular weight of 441.35 g/mol. Its IUPAC name is [(2S)-5-bromo-2-[(2S,3S,5R)-3-methyl-5-tritiooxolan-2-yl]pentyl]-[(2R,3S,5R)-2-(deuteriomethyl)-5-tritiooxolan-3-yl]oxy-(2-isocyanoethoxy)phosphane.
| Compound Name | [(2S)-5-bromo-2-[(2S,3S,5R)-3-methyl-5-tritiooxolan-2-yl]pentyl]-[(2R,3S,5R)-2-(deuteriomethyl)-5-tritiooxolan-3-yl]oxy-(2-isocyanoethoxy)phosphane |
|---|---|
| PubChem CID | 158910802 |
| Molecular Formula | C18H31BrNO4P |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [(2S)-5-bromo-2-[(2S,3S,5R)-3-methyl-5-tritiooxolan-2-yl]pentyl]-[(2R,3S,5R)-2-(deuteriomethyl)-5-tritiooxolan-3-yl]oxy-(2-isocyanoethoxy)phosphane |
| SMILES | [2H]C[C@H]1O[C@H]([3H])C[C@@H]1OP(C[C@@H](CCCBr)[C@H]1O[C@H]([3H])C[C@@H]1C)OCC[N+]#[C-] |
| InChI | InChI=1S/C18H31BrNO4P/c1-14-6-10-22-18(14)16(5-4-8-19)13-25(23-12-9-20-3)24-17-7-11-21-15(17)2/h14-18H,4-13H2,1-2H3/t14-,15+,16+,17-,18-,25?/m0/s1/i2D,10T,11T/t10-,11-,14+,15-,16-,17+,18+,25?/m1 |
| InChIKey | NUGHJPLAVBTYHB-WBUSYQIGSA-N |
| XLogP | 4.64 |
| TPSA | 41.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|