C30H24N6O3S — CID 158911701
4-[6-methoxy-2-methyl-4-[[2-(1,3-oxazol-2-yl)-4-phenyl-1,3-thiazol-5-yl]methyl]-9H-pyrimido[4,5-b]indol-7-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 158911701) has the molecular formula C30H24N6O3S and a molecular weight of 548.63 g/mol. Its IUPAC name is 4-[6-methoxy-2-methyl-4-[[2-(1,3-oxazol-2-yl)-4-phenyl-1,3-thiazol-5-yl]methyl]-9H-pyrimido[4,5-b]indol-7-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[6-methoxy-2-methyl-4-[[2-(1,3-oxazol-2-yl)-4-phenyl-1,3-thiazol-5-yl]methyl]-9H-pyrimido[4,5-b]indol-7-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 158911701 |
| Molecular Formula | C30H24N6O3S |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 4-[6-methoxy-2-methyl-4-[[2-(1,3-oxazol-2-yl)-4-phenyl-1,3-thiazol-5-yl]methyl]-9H-pyrimido[4,5-b]indol-7-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | COc1cc2c(cc1-c1c(C)noc1C)[nH]c1nc(C)nc(Cc3sc(-c4ncco4)nc3-c3ccccc3)c12 |
| InChI | InChI=1S/C30H24N6O3S/c1-15-25(16(2)39-36-15)20-12-21-19(13-23(20)37-4)26-22(32-17(3)33-28(26)34-21)14-24-27(18-8-6-5-7-9-18)35-30(40-24)29-31-10-11-38-29/h5-13H,14H2,1-4H3,(H,32,33,34) |
| InChIKey | JGSRGQBNZKLABS-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 115.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |