About nonyl 2-phenoxyethoxy sulfate
nonyl 2-phenoxyethoxy sulfate (PubChem CID 158912103) has the molecular formula C17H28O6S
and a molecular weight of 360.47 g/mol. Its IUPAC name is nonyl 2-phenoxyethoxy sulfate.
Molecular Properties
| Compound Name | nonyl 2-phenoxyethoxy sulfate |
| PubChem CID | 158912103 |
| Molecular Formula | C17H28O6S |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | nonyl 2-phenoxyethoxy sulfate |
| SMILES | CCCCCCCCCOS(=O)(=O)OOCCOc1ccccc1 |
| InChI | InChI=1S/C17H28O6S/c1-2-3-4-5-6-7-11-14-22-24(18,19)23-21-16-15-20-17-12-9-8-10-13-17/h8-10,12-13H,2-7,11,14-16H2,1H3 |
| InChIKey | OMMXDUUGNZIDIK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze nonyl 2-phenoxyethoxy sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonyl 2-phenoxyethoxy sulfate?
The IUPAC name of nonyl 2-phenoxyethoxy sulfate (CID 158912103) is nonyl 2-phenoxyethoxy sulfate.
What is the SMILES notation for nonyl 2-phenoxyethoxy sulfate?
The canonical SMILES for nonyl 2-phenoxyethoxy sulfate is CCCCCCCCCOS(=O)(=O)OOCCOc1ccccc1.
What is the InChIKey of nonyl 2-phenoxyethoxy sulfate?
The InChIKey is OMMXDUUGNZIDIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O6S/c1-2-3-4-5-6-7-11-14-22-24(18,19)23-21-16-15-20-17-12-9-8-10-13-17/h8-10,12-13H,2-7,11,14-16H2,1H3.
What are the key properties of nonyl 2-phenoxyethoxy sulfate?
nonyl 2-phenoxyethoxy sulfate has a molecular weight of 360.47 g/mol, XLogP of 4.03, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nonyl 2-phenoxyethoxy sulfate is sourced from PubChem (CID 158912103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).