C27H37N7O2 — CID 158912310
5-amino-1-[4-[[4-[1-(4-methylphenyl)pyrazolo[5,4-c]pyridin-3-yl]morpholin-2-yl]methyl]piperazin-1-yl]pentan-1-one (PubChem CID 158912310) has the molecular formula C27H37N7O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 5-amino-1-[4-[[4-[1-(4-methylphenyl)pyrazolo[5,4-c]pyridin-3-yl]morpholin-2-yl]methyl]piperazin-1-yl]pentan-1-one.
| Compound Name | 5-amino-1-[4-[[4-[1-(4-methylphenyl)pyrazolo[5,4-c]pyridin-3-yl]morpholin-2-yl]methyl]piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 158912310 |
| Molecular Formula | C27H37N7O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | 5-amino-1-[4-[[4-[1-(4-methylphenyl)pyrazolo[5,4-c]pyridin-3-yl]morpholin-2-yl]methyl]piperazin-1-yl]pentan-1-one |
| SMILES | Cc1ccc(-n2nc(N3CCOC(CN4CCN(C(=O)CCCCN)CC4)C3)c3ccncc32)cc1 |
| InChI | InChI=1S/C27H37N7O2/c1-21-5-7-22(8-6-21)34-25-18-29-11-9-24(25)27(30-34)33-16-17-36-23(20-33)19-31-12-14-32(15-13-31)26(35)4-2-3-10-28/h5-9,11,18,23H,2-4,10,12-17,19-20,28H2,1H3 |
| InChIKey | JGUNCRAJNVTJBJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|