C39H70O4 — CID 158913517
ethyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate;3-methylbutyl dodecanoate (PubChem CID 158913517) has the molecular formula C39H70O4 and a molecular weight of 602.99 g/mol. Its IUPAC name is ethyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate;3-methylbutyl dodecanoate.
| Compound Name | ethyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate;3-methylbutyl dodecanoate |
|---|---|
| PubChem CID | 158913517 |
| Molecular Formula | C39H70O4 |
| Molecular Weight | 602.99 g/mol |
| Exact Mass | 602.53 |
| IUPAC Name | ethyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate;3-methylbutyl dodecanoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC.CCCCCCCCCCCC(=O)OCCC(C)C |
| InChI | InChI=1S/C22H36O2.C17H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2;1-4-5-6-7-8-9-10-11-12-13-17(18)19-15-14-16(2)3/h8-9,11-12,14-15,17-18H,3-7,10,13,16,19-21H2,1-2H3;16H,4-15H2,1-3H3/b9-8-,12-11-,15-14-,18-17-; |
| InChIKey | JGYFYARJEJBACE-OBUFPCJFSA-N |
| XLogP | 12.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.99 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|