About 4-fluorobenzenethiol
4-fluorobenzenethiol (PubChem CID 158914451) has the molecular formula C12H10F2S2
and a molecular weight of 256.34 g/mol. Its IUPAC name is 4-fluorobenzenethiol.
Molecular Properties
| Compound Name | 4-fluorobenzenethiol |
| PubChem CID | 158914451 |
| Molecular Formula | C12H10F2S2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 4-fluorobenzenethiol |
| SMILES | Fc1ccc(S)cc1.Fc1ccc(S)cc1 |
| InChI | InChI=1S/2C6H5FS/c2*7-5-1-3-6(8)4-2-5/h2*1-4,8H |
| InChIKey | JHBCWQQAKZBCPI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobenzenethiol?
The IUPAC name of 4-fluorobenzenethiol (CID 158914451) is 4-fluorobenzenethiol.
What is the SMILES notation for 4-fluorobenzenethiol?
The canonical SMILES for 4-fluorobenzenethiol is Fc1ccc(S)cc1.Fc1ccc(S)cc1.
What is the InChIKey of 4-fluorobenzenethiol?
The InChIKey is JHBCWQQAKZBCPI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5FS/c2*7-5-1-3-6(8)4-2-5/h2*1-4,8H.
What are the key properties of 4-fluorobenzenethiol?
4-fluorobenzenethiol has a molecular weight of 256.34 g/mol, XLogP of 4.23, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobenzenethiol is sourced from PubChem (CID 158914451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).