C12H21F3N2O3 — CID 158914644
(2S)-2-amino-1-[(3R)-3-hydroxypyrrolidin-1-yl]-3,3-dimethylbutan-1-one;2,2,2-trifluoroacetaldehyde (PubChem CID 158914644) has the molecular formula C12H21F3N2O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is (2S)-2-amino-1-[(3R)-3-hydroxypyrrolidin-1-yl]-3,3-dimethylbutan-1-one;2,2,2-trifluoroacetaldehyde.
| Compound Name | (2S)-2-amino-1-[(3R)-3-hydroxypyrrolidin-1-yl]-3,3-dimethylbutan-1-one;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 158914644 |
| Molecular Formula | C12H21F3N2O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (2S)-2-amino-1-[(3R)-3-hydroxypyrrolidin-1-yl]-3,3-dimethylbutan-1-one;2,2,2-trifluoroacetaldehyde |
| SMILES | CC(C)(C)[C@H](N)C(=O)N1CC[C@@H](O)C1.O=CC(F)(F)F |
| InChI | InChI=1S/C10H20N2O2.C2HF3O/c1-10(2,3)8(11)9(14)12-5-4-7(13)6-12;3-2(4,5)1-6/h7-8,13H,4-6,11H2,1-3H3;1H/t7-,8-;/m1./s1 |
| InChIKey | JHBRYUYWOLPJFI-SCLLHFNJSA-N |
| XLogP | 0.70 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|