C18H24N4OSi — CID 15891468
6-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylcyclohex-4-ene-1,1,2,2-tetracarbonitrile (PubChem CID 15891468) has the molecular formula C18H24N4OSi and a molecular weight of 340.50 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylcyclohex-4-ene-1,1,2,2-tetracarbonitrile.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylcyclohex-4-ene-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 15891468 |
| Molecular Formula | C18H24N4OSi |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylcyclohex-4-ene-1,1,2,2-tetracarbonitrile |
| SMILES | CC1(C)C=CC(O[Si](C)(C)C(C)(C)C)C(C#N)(C#N)C1(C#N)C#N |
| InChI | InChI=1S/C18H24N4OSi/c1-15(2,3)24(6,7)23-14-8-9-16(4,5)18(12-21,13-22)17(14,10-19)11-20/h8-9,14H,1-7H3 |
| InChIKey | UJPWXONQEGQAOK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|