C24H26N4O — CID 158915048
1-[1-(4-isocyanophenyl)-2,6-dimethylpyrrolo[3,2-b]pyridin-3-yl]-2-[(2R)-2-methylpiperidin-1-yl]ethanone (PubChem CID 158915048) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-[1-(4-isocyanophenyl)-2,6-dimethylpyrrolo[3,2-b]pyridin-3-yl]-2-[(2R)-2-methylpiperidin-1-yl]ethanone.
| Compound Name | 1-[1-(4-isocyanophenyl)-2,6-dimethylpyrrolo[3,2-b]pyridin-3-yl]-2-[(2R)-2-methylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 158915048 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1-[1-(4-isocyanophenyl)-2,6-dimethylpyrrolo[3,2-b]pyridin-3-yl]-2-[(2R)-2-methylpiperidin-1-yl]ethanone |
| SMILES | [C-]#[N+]c1ccc(-n2c(C)c(C(=O)CN3CCCC[C@H]3C)c3ncc(C)cc32)cc1 |
| InChI | InChI=1S/C24H26N4O/c1-16-13-21-24(26-14-16)23(22(29)15-27-12-6-5-7-17(27)2)18(3)28(21)20-10-8-19(25-4)9-11-20/h8-11,13-14,17H,5-7,12,15H2,1-3H3/t17-/m1/s1 |
| InChIKey | BURVJAYTQUOTIP-QGZVFWFLSA-N |
| XLogP | 5.25 |
| TPSA | 42.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|