C21H30N4O2 — CID 158915340
4-benzamido-N-(4-tert-butylcyclohexyl)-1H-pyrazole-5-carboxamide;molecular hydrogen (PubChem CID 158915340) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 4-benzamido-N-(4-tert-butylcyclohexyl)-1H-pyrazole-5-carboxamide;molecular hydrogen.
| Compound Name | 4-benzamido-N-(4-tert-butylcyclohexyl)-1H-pyrazole-5-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 158915340 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 4-benzamido-N-(4-tert-butylcyclohexyl)-1H-pyrazole-5-carboxamide;molecular hydrogen |
| SMILES | CC(C)(C)C1CCC(NC(=O)c2[nH]ncc2NC(=O)c2ccccc2)CC1.[H][H] |
| InChI | InChI=1S/C21H28N4O2.H2/c1-21(2,3)15-9-11-16(12-10-15)23-20(27)18-17(13-22-25-18)24-19(26)14-7-5-4-6-8-14;/h4-8,13,15-16H,9-12H2,1-3H3,(H,22,25)(H,23,27)(H,24,26);1H |
| InChIKey | JHDUPVMLRMZOLW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |