About CID 158915409
CID 158915409 (PubChem CID 158915409) has the molecular formula C28H39ClNO2Sn
and a molecular weight of 575.79 g/mol.
Molecular Properties
| Compound Name | CID 158915409 |
| PubChem CID | 158915409 |
| Molecular Formula | C28H39ClNO2Sn |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | — |
| SMILES | C=Cc1c(C(=O)OCC)cnc2c(Cl)cccc12.CCCCC([Sn])=C(CCCC)CCCC |
| InChI | InChI=1S/C14H12ClNO2.C14H27.Sn/c1-3-9-10-6-5-7-12(15)13(10)16-8-11(9)14(17)18-4-2;1-4-7-10-13-14(11-8-5-2)12-9-6-3;/h3,5-8H,1,4H2,2H3;4-12H2,1-3H3; |
| InChIKey | JHDZXZQEBXYQIE-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 158915409 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158915409?
The IUPAC name of CID 158915409 (CID 158915409) is not available.
What is the SMILES notation for CID 158915409?
The canonical SMILES for CID 158915409 is C=Cc1c(C(=O)OCC)cnc2c(Cl)cccc12.CCCCC([Sn])=C(CCCC)CCCC.
What is the InChIKey of CID 158915409?
The InChIKey is JHDZXZQEBXYQIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClNO2.C14H27.Sn/c1-3-9-10-6-5-7-12(15)13(10)16-8-11(9)14(17)18-4-2;1-4-7-10-13-14(11-8-5-2)12-9-6-3;/h3,5-8H,1,4H2,2H3;4-12H2,1-3H3;.
What are the key properties of CID 158915409?
CID 158915409 has a molecular weight of 575.79 g/mol, XLogP of 8.69, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158915409 is sourced from PubChem (CID 158915409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).