C14H11Cl4NO6 — CID 15891738
2-(2-hydroxyethoxy)ethyl 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 15891738) has the molecular formula C14H11Cl4NO6 and a molecular weight of 431.06 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 15891738 |
| Molecular Formula | C14H11Cl4NO6 |
| Molecular Weight | 431.06 g/mol |
| Exact Mass | 428.93 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O)OCCOCCO |
| InChI | InChI=1S/C14H11Cl4NO6/c15-9-7-8(10(16)12(18)11(9)17)14(23)19(13(7)22)5-6(21)25-4-3-24-2-1-20/h20H,1-5H2 |
| InChIKey | LHSMPUFWUWZVAZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.06 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|