C15H15NO4S — CID 15891844
dimethyl 4-methyl-2-phenyl-4H-1,3-thiazine-5,6-dicarboxylate (PubChem CID 15891844) has the molecular formula C15H15NO4S and a molecular weight of 305.36 g/mol. Its IUPAC name is dimethyl 4-methyl-2-phenyl-4H-1,3-thiazine-5,6-dicarboxylate.
| Compound Name | dimethyl 4-methyl-2-phenyl-4H-1,3-thiazine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 15891844 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | dimethyl 4-methyl-2-phenyl-4H-1,3-thiazine-5,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C)N=C(c2ccccc2)S1 |
| InChI | InChI=1S/C15H15NO4S/c1-9-11(14(17)19-2)12(15(18)20-3)21-13(16-9)10-7-5-4-6-8-10/h4-9H,1-3H3 |
| InChIKey | RXPXEBMEFYJCBE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |