C24H46O4Si — CID 158918547
(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-ol;(1R,4S)-2,6,6-trimethylcyclohex-2-ene-1,4-diol (PubChem CID 158918547) has the molecular formula C24H46O4Si and a molecular weight of 426.71 g/mol. Its IUPAC name is (1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-ol;(1R,4S)-2,6,6-trimethylcyclohex-2-ene-1,4-diol.
| Compound Name | (1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-ol;(1R,4S)-2,6,6-trimethylcyclohex-2-ene-1,4-diol |
|---|---|
| PubChem CID | 158918547 |
| Molecular Formula | C24H46O4Si |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | (1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-ol;(1R,4S)-2,6,6-trimethylcyclohex-2-ene-1,4-diol |
| SMILES | CC1=C[C@@H](O)CC(C)(C)[C@H]1O.CC1=C[C@@H](O[Si](C)(C)C(C)(C)C)CC(C)(C)[C@H]1O |
| InChI | InChI=1S/C15H30O2Si.C9H16O2/c1-11-9-12(10-15(5,6)13(11)16)17-18(7,8)14(2,3)4;1-6-4-7(10)5-9(2,3)8(6)11/h9,12-13,16H,10H2,1-8H3;4,7-8,10-11H,5H2,1-3H3/t12-,13+;7-,8+/m11/s1 |
| InChIKey | JHNSOCUZCNYJJC-KPYSKOJTSA-N |
| XLogP | 5.20 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|