C37H37BClFN2O8 — CID 158918665
ethyl 7-[(3-chloro-2-fluorophenyl)methyl]-4-oxoquinolizine-3-carboxylate;ethyl 4-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolizine-3-carboxylate (PubChem CID 158918665) has the molecular formula C37H37BClFN2O8 and a molecular weight of 702.97 g/mol. Its IUPAC name is ethyl 7-[(3-chloro-2-fluorophenyl)methyl]-4-oxoquinolizine-3-carboxylate;ethyl 4-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolizine-3-carboxylate.
| Compound Name | ethyl 7-[(3-chloro-2-fluorophenyl)methyl]-4-oxoquinolizine-3-carboxylate;ethyl 4-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 158918665 |
| Molecular Formula | C37H37BClFN2O8 |
| Molecular Weight | 702.97 g/mol |
| Exact Mass | 702.23 |
| IUPAC Name | ethyl 7-[(3-chloro-2-fluorophenyl)methyl]-4-oxoquinolizine-3-carboxylate;ethyl 4-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolizine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc2ccc(B3OC(C)(C)C(C)(C)O3)cn2c1=O.CCOC(=O)c1ccc2ccc(Cc3cccc(Cl)c3F)cn2c1=O |
| InChI | InChI=1S/C19H15ClFNO3.C18H22BNO5/c1-2-25-19(24)15-9-8-14-7-6-12(11-22(14)18(15)23)10-13-4-3-5-16(20)17(13)21;1-6-23-16(22)14-10-9-13-8-7-12(11-20(13)15(14)21)19-24-17(2,3)18(4,5)25-19/h3-9,11H,2,10H2,1H3;7-11H,6H2,1-5H3 |
| InChIKey | JHOCBTNYKVAQTB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 114.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.97 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|