C18H28O2Si — CID 158918803
(3aE,6S,8Z)-6-[tert-butyl(dimethyl)silyl]oxy-6,7,10,10a-tetrahydro-5H-cyclopenta[9]annulen-3-one (PubChem CID 158918803) has the molecular formula C18H28O2Si and a molecular weight of 304.51 g/mol. Its IUPAC name is (3aE,6S,8Z)-6-[tert-butyl(dimethyl)silyl]oxy-6,7,10,10a-tetrahydro-5H-cyclopenta[9]annulen-3-one.
| Compound Name | (3aE,6S,8Z)-6-[tert-butyl(dimethyl)silyl]oxy-6,7,10,10a-tetrahydro-5H-cyclopenta[9]annulen-3-one |
|---|---|
| PubChem CID | 158918803 |
| Molecular Formula | C18H28O2Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (3aE,6S,8Z)-6-[tert-butyl(dimethyl)silyl]oxy-6,7,10,10a-tetrahydro-5H-cyclopenta[9]annulen-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C/C=C\CC2C=CC(=O)/C2=C/C1 |
| InChI | InChI=1S/C18H28O2Si/c1-18(2,3)21(4,5)20-15-9-7-6-8-14-10-13-17(19)16(14)12-11-15/h6-7,10,12-15H,8-9,11H2,1-5H3/b7-6-,16-12+/t14?,15-/m0/s1 |
| InChIKey | KNMCROTWOXYXJY-MIELZZHUSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|