C33H33F2N7O4 — CID 158918922
N-(1-benzylimidazol-4-yl)-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide;1-benzyl-4-nitroimidazole (PubChem CID 158918922) has the molecular formula C33H33F2N7O4 and a molecular weight of 629.67 g/mol. Its IUPAC name is N-(1-benzylimidazol-4-yl)-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide;1-benzyl-4-nitroimidazole.
| Compound Name | N-(1-benzylimidazol-4-yl)-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide;1-benzyl-4-nitroimidazole |
|---|---|
| PubChem CID | 158918922 |
| Molecular Formula | C33H33F2N7O4 |
| Molecular Weight | 629.67 g/mol |
| Exact Mass | 629.26 |
| IUPAC Name | N-(1-benzylimidazol-4-yl)-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide;1-benzyl-4-nitroimidazole |
| SMILES | CCCC(NC(=O)Cc1cc(F)cc(F)c1)C(=O)Nc1cn(Cc2ccccc2)cn1.O=[N+]([O-])c1cn(Cc2ccccc2)cn1 |
| InChI | InChI=1S/C23H24F2N4O2.C10H9N3O2/c1-2-6-20(27-22(30)11-17-9-18(24)12-19(25)10-17)23(31)28-21-14-29(15-26-21)13-16-7-4-3-5-8-16;14-13(15)10-7-12(8-11-10)6-9-4-2-1-3-5-9/h3-5,7-10,12,14-15,20H,2,6,11,13H2,1H3,(H,27,30)(H,28,31);1-5,7-8H,6H2 |
| InChIKey | JHOXLURPVXCLLG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.67 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|