C27H28N4O3S — CID 158920025
4-[(4-oxo-3H-quinolin-2-yl)sulfanyl]-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)cyclohexyl]butanamide (PubChem CID 158920025) has the molecular formula C27H28N4O3S and a molecular weight of 488.61 g/mol. Its IUPAC name is 4-[(4-oxo-3H-quinolin-2-yl)sulfanyl]-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)cyclohexyl]butanamide.
| Compound Name | 4-[(4-oxo-3H-quinolin-2-yl)sulfanyl]-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)cyclohexyl]butanamide |
|---|---|
| PubChem CID | 158920025 |
| Molecular Formula | C27H28N4O3S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 4-[(4-oxo-3H-quinolin-2-yl)sulfanyl]-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)cyclohexyl]butanamide |
| SMILES | O=C(CCCSC1=Nc2ccccc2C(=O)C1)NC1CCC(c2nnc(-c3ccccc3)o2)CC1 |
| InChI | InChI=1S/C27H28N4O3S/c32-23-17-25(29-22-10-5-4-9-21(22)23)35-16-6-11-24(33)28-20-14-12-19(13-15-20)27-31-30-26(34-27)18-7-2-1-3-8-18/h1-5,7-10,19-20H,6,11-17H2,(H,28,33) |
| InChIKey | JHSISQBVJMUUGZ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|