C15H8F2O2 — CID 15892031
(3Z)-3-[(3,5-difluorophenyl)methylidene]-2-benzofuran-1-one (PubChem CID 15892031) has the molecular formula C15H8F2O2 and a molecular weight of 258.22 g/mol. Its IUPAC name is (3Z)-3-[(3,5-difluorophenyl)methylidene]-2-benzofuran-1-one.
| Compound Name | (3Z)-3-[(3,5-difluorophenyl)methylidene]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 15892031 |
| Molecular Formula | C15H8F2O2 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | (3Z)-3-[(3,5-difluorophenyl)methylidene]-2-benzofuran-1-one |
| SMILES | O=C1O/C(=C\c2cc(F)cc(F)c2)c2ccccc21 |
| InChI | InChI=1S/C15H8F2O2/c16-10-5-9(6-11(17)8-10)7-14-12-3-1-2-4-13(12)15(18)19-14/h1-8H/b14-7- |
| InChIKey | WUBPZAPRFGPXRB-AUWJEWJLSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|