C37H53N3 — CID 15892085
1,2,3-tris[2,6-di(propan-2-yl)phenyl]guanidine (PubChem CID 15892085) has the molecular formula C37H53N3 and a molecular weight of 539.85 g/mol. Its IUPAC name is 1,2,3-tris[2,6-di(propan-2-yl)phenyl]guanidine.
| Compound Name | 1,2,3-tris[2,6-di(propan-2-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 15892085 |
| Molecular Formula | C37H53N3 |
| Molecular Weight | 539.85 g/mol |
| Exact Mass | 539.42 |
| IUPAC Name | 1,2,3-tris[2,6-di(propan-2-yl)phenyl]guanidine |
| SMILES | CC(C)c1cccc(C(C)C)c1N=C(Nc1c(C(C)C)cccc1C(C)C)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C37H53N3/c1-22(2)28-16-13-17-29(23(3)4)34(28)38-37(39-35-30(24(5)6)18-14-19-31(35)25(7)8)40-36-32(26(9)10)20-15-21-33(36)27(11)12/h13-27H,1-12H3,(H2,38,39,40) |
| InChIKey | JLOJDMUZPWYGLY-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.85 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|