C28H36Cl4N4O4 — CID 158921013
N-[(4,5-dichloro-2-methoxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 158921013) has the molecular formula C28H36Cl4N4O4 and a molecular weight of 634.43 g/mol. Its IUPAC name is N-[(4,5-dichloro-2-methoxyphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[(4,5-dichloro-2-methoxyphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 158921013 |
| Molecular Formula | C28H36Cl4N4O4 |
| Molecular Weight | 634.43 g/mol |
| Exact Mass | 632.15 |
| IUPAC Name | N-[(4,5-dichloro-2-methoxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | COc1cc(Cl)c(Cl)cc1CNC(=O)C1CCNCC1.COc1cc(Cl)c(Cl)cc1CNC(=O)C1CCNCC1 |
| InChI | InChI=1S/2C14H18Cl2N2O2/c2*1-20-13-7-12(16)11(15)6-10(13)8-18-14(19)9-2-4-17-5-3-9/h2*6-7,9,17H,2-5,8H2,1H3,(H,18,19) |
| InChIKey | JHVHUBQHAUVGKN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |