C22H35F5N10O2 — CID 158921466
N-(6-aminohexyl)acetamide;N-[6-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]hexyl]acetamide;2,4,6-trifluoro-1,3,5-triazine (PubChem CID 158921466) has the molecular formula C22H35F5N10O2 and a molecular weight of 566.58 g/mol. Its IUPAC name is N-(6-aminohexyl)acetamide;N-[6-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]hexyl]acetamide;2,4,6-trifluoro-1,3,5-triazine.
| Compound Name | N-(6-aminohexyl)acetamide;N-[6-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]hexyl]acetamide;2,4,6-trifluoro-1,3,5-triazine |
|---|---|
| PubChem CID | 158921466 |
| Molecular Formula | C22H35F5N10O2 |
| Molecular Weight | 566.58 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | N-(6-aminohexyl)acetamide;N-[6-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]hexyl]acetamide;2,4,6-trifluoro-1,3,5-triazine |
| SMILES | CC(=O)NCCCCCCN.CC(=O)NCCCCCCNc1nc(F)nc(F)n1.Fc1nc(F)nc(F)n1 |
| InChI | InChI=1S/C11H17F2N5O.C8H18N2O.C3F3N3/c1-8(19)14-6-4-2-3-5-7-15-11-17-9(12)16-10(13)18-11;1-8(11)10-7-5-3-2-4-6-9;4-1-7-2(5)9-3(6)8-1/h2-7H2,1H3,(H,14,19)(H,15,16,17,18);2-7,9H2,1H3,(H,10,11); |
| InChIKey | JHWSGOHUJPCLCQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 173.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.58 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|