About 3,4-ditert-butylpyridazine;ethane
3,4-ditert-butylpyridazine;ethane (PubChem CID 158921658) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is 3,4-ditert-butylpyridazine;ethane.
Molecular Properties
| Compound Name | 3,4-ditert-butylpyridazine;ethane |
| PubChem CID | 158921658 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 3,4-ditert-butylpyridazine;ethane |
| SMILES | CC.CC(C)(C)c1ccnnc1C(C)(C)C |
| InChI | InChI=1S/C12H20N2.C2H6/c1-11(2,3)9-7-8-13-14-10(9)12(4,5)6;1-2/h7-8H,1-6H3;1-2H3 |
| InChIKey | JHXHDAICZYNGSE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-ditert-butylpyridazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-ditert-butylpyridazine;ethane?
The IUPAC name of 3,4-ditert-butylpyridazine;ethane (CID 158921658) is 3,4-ditert-butylpyridazine;ethane.
What is the SMILES notation for 3,4-ditert-butylpyridazine;ethane?
The canonical SMILES for 3,4-ditert-butylpyridazine;ethane is CC.CC(C)(C)c1ccnnc1C(C)(C)C.
What is the InChIKey of 3,4-ditert-butylpyridazine;ethane?
The InChIKey is JHXHDAICZYNGSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2.C2H6/c1-11(2,3)9-7-8-13-14-10(9)12(4,5)6;1-2/h7-8H,1-6H3;1-2H3.
What are the key properties of 3,4-ditert-butylpyridazine;ethane?
3,4-ditert-butylpyridazine;ethane has a molecular weight of 222.38 g/mol, XLogP of 4.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-ditert-butylpyridazine;ethane is sourced from PubChem (CID 158921658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).