About 4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole
4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole (PubChem CID 15892196) has the molecular formula C21H19NOS2
and a molecular weight of 365.52 g/mol. Its IUPAC name is 4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole.
Molecular Properties
| Compound Name | 4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole |
| PubChem CID | 15892196 |
| Molecular Formula | C21H19NOS2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole |
| SMILES | Cc1cc(-c2nc(-c3ccccc3)oc2-c2cc(C)sc2C)c(C)s1 |
| InChI | InChI=1S/C21H19NOS2/c1-12-10-17(14(3)24-12)19-20(18-11-13(2)25-15(18)4)23-21(22-19)16-8-6-5-7-9-16/h5-11H,1-4H3 |
| InChIKey | KNZRYWOGOASDHQ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole?
The IUPAC name of 4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole (CID 15892196) is 4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole.
What is the SMILES notation for 4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole?
The canonical SMILES for 4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole is Cc1cc(-c2nc(-c3ccccc3)oc2-c2cc(C)sc2C)c(C)s1.
What is the InChIKey of 4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole?
The InChIKey is KNZRYWOGOASDHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NOS2/c1-12-10-17(14(3)24-12)19-20(18-11-13(2)25-15(18)4)23-21(22-19)16-8-6-5-7-9-16/h5-11H,1-4H3.
What are the key properties of 4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole?
4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole has a molecular weight of 365.52 g/mol, XLogP of 7.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(2,5-dimethylthiophen-3-yl)-2-phenyl-1,3-oxazole is sourced from PubChem (CID 15892196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).