C30H32O2S4 — CID 158923678
11,12-dihydrobenzo[c][1,2]benzodithiocine 5,6-dioxide;ethane;2-[2-(2-sulfanylphenyl)ethyl]benzenethiol (PubChem CID 158923678) has the molecular formula C30H32O2S4 and a molecular weight of 552.85 g/mol. Its IUPAC name is 11,12-dihydrobenzo[c][1,2]benzodithiocine 5,6-dioxide;ethane;2-[2-(2-sulfanylphenyl)ethyl]benzenethiol.
| Compound Name | 11,12-dihydrobenzo[c][1,2]benzodithiocine 5,6-dioxide;ethane;2-[2-(2-sulfanylphenyl)ethyl]benzenethiol |
|---|---|
| PubChem CID | 158923678 |
| Molecular Formula | C30H32O2S4 |
| Molecular Weight | 552.85 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 11,12-dihydrobenzo[c][1,2]benzodithiocine 5,6-dioxide;ethane;2-[2-(2-sulfanylphenyl)ethyl]benzenethiol |
| SMILES | CC.O=S1c2ccccc2CCc2ccccc2S1=O.Sc1ccccc1CCc1ccccc1S |
| InChI | InChI=1S/C14H12O2S2.C14H14S2.C2H6/c15-17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)18(17)16;15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)16;1-2/h1-8H,9-10H2;1-8,15-16H,9-10H2;1-2H3 |
| InChIKey | JIDVOGZIRSTMRK-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.85 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|