C32H31N3O5 — CID 158924643
benzhydryl (2R,6E)-3,3-dimethyl-7-oxo-6-[[5-(prop-2-enoxycarbonylamino)-2-pyridinyl]methylidene]-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 158924643) has the molecular formula C32H31N3O5 and a molecular weight of 537.62 g/mol. Its IUPAC name is benzhydryl (2R,6E)-3,3-dimethyl-7-oxo-6-[[5-(prop-2-enoxycarbonylamino)-2-pyridinyl]methylidene]-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzhydryl (2R,6E)-3,3-dimethyl-7-oxo-6-[[5-(prop-2-enoxycarbonylamino)-2-pyridinyl]methylidene]-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 158924643 |
| Molecular Formula | C32H31N3O5 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | benzhydryl (2R,6E)-3,3-dimethyl-7-oxo-6-[[5-(prop-2-enoxycarbonylamino)-2-pyridinyl]methylidene]-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C=CCOC(=O)Nc1ccc(/C=C2/C(=O)N3C2CC(C)(C)[C@@H]3C(=O)OC(c2ccccc2)c2ccccc2)nc1 |
| InChI | InChI=1S/C32H31N3O5/c1-4-17-39-31(38)34-24-16-15-23(33-20-24)18-25-26-19-32(2,3)28(35(26)29(25)36)30(37)40-27(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h4-16,18,20,26-28H,1,17,19H2,2-3H3,(H,34,38)/b25-18+/t26?,28-/m0/s1 |
| InChIKey | BGDNZCZNOGFNKY-LNQFXDPCSA-N |
| XLogP | 5.54 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|