C15H16F2O7S — CID 158925962
1,1-difluoro-2-[(E)-4-oxo-4-(2,4,6-trimethylphenoxy)but-2-enoyl]oxyethanesulfonic acid (PubChem CID 158925962) has the molecular formula C15H16F2O7S and a molecular weight of 378.35 g/mol. Its IUPAC name is 1,1-difluoro-2-[(E)-4-oxo-4-(2,4,6-trimethylphenoxy)but-2-enoyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[(E)-4-oxo-4-(2,4,6-trimethylphenoxy)but-2-enoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 158925962 |
| Molecular Formula | C15H16F2O7S |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 1,1-difluoro-2-[(E)-4-oxo-4-(2,4,6-trimethylphenoxy)but-2-enoyl]oxyethanesulfonic acid |
| SMILES | Cc1cc(C)c(OC(=O)/C=C/C(=O)OCC(F)(F)S(=O)(=O)O)c(C)c1 |
| InChI | InChI=1S/C15H16F2O7S/c1-9-6-10(2)14(11(3)7-9)24-13(19)5-4-12(18)23-8-15(16,17)25(20,21)22/h4-7H,8H2,1-3H3,(H,20,21,22)/b5-4+ |
| InChIKey | FNEXLJRXHHXNRH-SNAWJCMRSA-N |
| XLogP | 2.10 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|