C16H18OSi — CID 15892631
3,3-dimethyl-3-silatetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraen-10-one (PubChem CID 15892631) has the molecular formula C16H18OSi and a molecular weight of 254.41 g/mol. Its IUPAC name is 3,3-dimethyl-3-silatetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraen-10-one.
| Compound Name | 3,3-dimethyl-3-silatetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraen-10-one |
|---|---|
| PubChem CID | 15892631 |
| Molecular Formula | C16H18OSi |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3,3-dimethyl-3-silatetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraen-10-one |
| SMILES | C[Si]1(C)c2ccccc2C(=O)C2C3C=CC(C3)C21 |
| InChI | InChI=1S/C16H18OSi/c1-18(2)13-6-4-3-5-12(13)15(17)14-10-7-8-11(9-10)16(14)18/h3-8,10-11,14,16H,9H2,1-2H3 |
| InChIKey | TXEOWUWJLQAAPT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|