C6H6F5NO — CID 15892726
(E)-4,4,5,5,5-pentafluoro-1-(methylamino)pent-1-en-3-one (PubChem CID 15892726) has the molecular formula C6H6F5NO and a molecular weight of 203.11 g/mol. Its IUPAC name is (E)-4,4,5,5,5-pentafluoro-1-(methylamino)pent-1-en-3-one.
| Compound Name | (E)-4,4,5,5,5-pentafluoro-1-(methylamino)pent-1-en-3-one |
|---|---|
| PubChem CID | 15892726 |
| Molecular Formula | C6H6F5NO |
| Molecular Weight | 203.11 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | (E)-4,4,5,5,5-pentafluoro-1-(methylamino)pent-1-en-3-one |
| SMILES | CN/C=C/C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H6F5NO/c1-12-3-2-4(13)5(7,8)6(9,10)11/h2-3,12H,1H3/b3-2+ |
| InChIKey | WDAAQQITDRIBIY-NSCUHMNNSA-N |
| XLogP | 1.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.11 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|