C21H46O7Si2 — CID 158928265
1,9-bis(triethoxysilyl)nonan-5-one (PubChem CID 158928265) has the molecular formula C21H46O7Si2 and a molecular weight of 466.76 g/mol. Its IUPAC name is 1,9-bis(triethoxysilyl)nonan-5-one.
| Compound Name | 1,9-bis(triethoxysilyl)nonan-5-one |
|---|---|
| PubChem CID | 158928265 |
| Molecular Formula | C21H46O7Si2 |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 1,9-bis(triethoxysilyl)nonan-5-one |
| SMILES | CCO[Si](CCCCC(=O)CCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C21H46O7Si2/c1-7-23-29(24-8-2,25-9-3)19-15-13-17-21(22)18-14-16-20-30(26-10-4,27-11-5)28-12-6/h7-20H2,1-6H3 |
| InChIKey | VLFMCDUNKIRLOQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|