About 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine
5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine (PubChem CID 158929150) has the molecular formula C19H20N4O2S
and a molecular weight of 368.46 g/mol. Its IUPAC name is 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine.
Molecular Properties
| Compound Name | 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine |
| PubChem CID | 158929150 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine |
| SMILES | Nc1ncc(-c2cnc(C3CCOCC3)s2)cc1OCc1ccncc1 |
| InChI | InChI=1S/C19H20N4O2S/c20-18-16(25-12-13-1-5-21-6-2-13)9-15(10-22-18)17-11-23-19(26-17)14-3-7-24-8-4-14/h1-2,5-6,9-11,14H,3-4,7-8,12H2,(H2,20,22) |
| InChIKey | WPLYVKFBBIPKII-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine?
The IUPAC name of 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine (CID 158929150) is 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine.
What is the SMILES notation for 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine?
The canonical SMILES for 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine is Nc1ncc(-c2cnc(C3CCOCC3)s2)cc1OCc1ccncc1.
What is the InChIKey of 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine?
The InChIKey is WPLYVKFBBIPKII-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O2S/c20-18-16(25-12-13-1-5-21-6-2-13)9-15(10-22-18)17-11-23-19(26-17)14-3-7-24-8-4-14/h1-2,5-6,9-11,14H,3-4,7-8,12H2,(H2,20,22).
What are the key properties of 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine?
5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine has a molecular weight of 368.46 g/mol, XLogP of 3.66, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-(pyridin-4-ylmethoxy)pyridin-2-amine is sourced from PubChem (CID 158929150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).