C25H40N6O — CID 158929851
2-[10-imino-12-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)-3a,7a-dihydro-1-benzofuran-2-yl]dodecyl]guanidine (PubChem CID 158929851) has the molecular formula C25H40N6O and a molecular weight of 440.64 g/mol. Its IUPAC name is 2-[10-imino-12-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)-3a,7a-dihydro-1-benzofuran-2-yl]dodecyl]guanidine.
| Compound Name | 2-[10-imino-12-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)-3a,7a-dihydro-1-benzofuran-2-yl]dodecyl]guanidine |
|---|---|
| PubChem CID | 158929851 |
| Molecular Formula | C25H40N6O |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | 2-[10-imino-12-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)-3a,7a-dihydro-1-benzofuran-2-yl]dodecyl]guanidine |
| SMILES | [H]/N=C(\CCCCCCCCCN=C(N)N)CCC1=CC2C=C(C3=NCCCN3)C=CC2O1 |
| InChI | InChI=1S/C25H40N6O/c26-21(9-6-4-2-1-3-5-7-14-31-25(27)28)11-12-22-18-20-17-19(10-13-23(20)32-22)24-29-15-8-16-30-24/h10,13,17-18,20,23,26H,1-9,11-12,14-16H2,(H,29,30)(H4,27,28,31)/b26-21+ |
| InChIKey | JIXKCFQRIQZAEK-YYADALCUSA-N |
| XLogP | 3.97 |
| TPSA | 121.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|