About 3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine
3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine (PubChem CID 158930150) has the molecular formula C18H18BrN5S
and a molecular weight of 416.35 g/mol. Its IUPAC name is 3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine |
| PubChem CID | 158930150 |
| Molecular Formula | C18H18BrN5S |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCc1nc2cc(C3=NN=NC3)ccc2c2sc(Br)cc12 |
| InChI | InChI=1S/C18H18BrN5S/c1-24(2)7-3-4-14-13-9-17(19)25-18(13)12-6-5-11(8-15(12)21-14)16-10-20-23-22-16/h5-6,8-9H,3-4,7,10H2,1-2H3 |
| InChIKey | JIYJFDGWDHDUAT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 53.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine (CID 158930150) is 3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine is CN(C)CCCc1nc2cc(C3=NN=NC3)ccc2c2sc(Br)cc12.
What is the InChIKey of 3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine?
The InChIKey is JIYJFDGWDHDUAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrN5S/c1-24(2)7-3-4-14-13-9-17(19)25-18(13)12-6-5-11(8-15(12)21-14)16-10-20-23-22-16/h5-6,8-9H,3-4,7,10H2,1-2H3.
What are the key properties of 3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine?
3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine has a molecular weight of 416.35 g/mol, XLogP of 4.88, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-bromo-7-(4H-triazol-5-yl)thieno[3,2-c]quinolin-4-yl]-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 158930150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).