About N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine
N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine (PubChem CID 158930420) has the molecular formula C19H38F2N2O
and a molecular weight of 348.52 g/mol. Its IUPAC name is N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine.
Molecular Properties
| Compound Name | N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine |
| PubChem CID | 158930420 |
| Molecular Formula | C19H38F2N2O |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine |
| SMILES | CC(C)(C)NC1CCC(F)(F)CC1.CC(C)(C)NC1CCOCC1 |
| InChI | InChI=1S/C10H19F2N.C9H19NO/c1-9(2,3)13-8-4-6-10(11,12)7-5-8;1-9(2,3)10-8-4-6-11-7-5-8/h8,13H,4-7H2,1-3H3;8,10H,4-7H2,1-3H3 |
| InChIKey | JIZDNFJLBITXDC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine?
The IUPAC name of N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine (CID 158930420) is N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine.
What is the SMILES notation for N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine?
The canonical SMILES for N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine is CC(C)(C)NC1CCC(F)(F)CC1.CC(C)(C)NC1CCOCC1.
What is the InChIKey of N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine?
The InChIKey is JIZDNFJLBITXDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2N.C9H19NO/c1-9(2,3)13-8-4-6-10(11,12)7-5-8;1-9(2,3)10-8-4-6-11-7-5-8/h8,13H,4-7H2,1-3H3;8,10H,4-7H2,1-3H3.
What are the key properties of N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine?
N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine has a molecular weight of 348.52 g/mol, XLogP of 4.51, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4,4-difluorocyclohexan-1-amine;N-tert-butyloxan-4-amine is sourced from PubChem (CID 158930420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).