About 2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline
2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline (PubChem CID 158932290) has the molecular formula C22H22FN5
and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline.
Molecular Properties
| Compound Name | 2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline |
| PubChem CID | 158932290 |
| Molecular Formula | C22H22FN5 |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline |
| SMILES | Cc1cn2nc(-c3cc(F)c4nc(C5CCCCC5)cnc4c3)cc(C)c2n1 |
| InChI | InChI=1S/C22H22FN5/c1-13-8-18(27-28-12-14(2)25-22(13)28)16-9-17(23)21-19(10-16)24-11-20(26-21)15-6-4-3-5-7-15/h8-12,15H,3-7H2,1-2H3 |
| InChIKey | DFLRBYNDBIVMKA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline?
The IUPAC name of 2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline (CID 158932290) is 2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline.
What is the SMILES notation for 2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline?
The canonical SMILES for 2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline is Cc1cn2nc(-c3cc(F)c4nc(C5CCCCC5)cnc4c3)cc(C)c2n1.
What is the InChIKey of 2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline?
The InChIKey is DFLRBYNDBIVMKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22FN5/c1-13-8-18(27-28-12-14(2)25-22(13)28)16-9-17(23)21-19(10-16)24-11-20(26-21)15-6-4-3-5-7-15/h8-12,15H,3-7H2,1-2H3.
What are the key properties of 2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline?
2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline has a molecular weight of 375.45 g/mol, XLogP of 5.14, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroquinoxaline is sourced from PubChem (CID 158932290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).