C22H46N2 — CID 158932354
methane;3-propan-2-yl-3-azabicyclo[3.2.1]octane;8-propan-2-yl-8-azabicyclo[3.2.1]octane (PubChem CID 158932354) has the molecular formula C22H46N2 and a molecular weight of 338.62 g/mol. Its IUPAC name is methane;3-propan-2-yl-3-azabicyclo[3.2.1]octane;8-propan-2-yl-8-azabicyclo[3.2.1]octane.
| Compound Name | methane;3-propan-2-yl-3-azabicyclo[3.2.1]octane;8-propan-2-yl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 158932354 |
| Molecular Formula | C22H46N2 |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 338.37 |
| IUPAC Name | methane;3-propan-2-yl-3-azabicyclo[3.2.1]octane;8-propan-2-yl-8-azabicyclo[3.2.1]octane |
| SMILES | C.C.CC(C)N1C2CCCC1CC2.CC(C)N1CC2CCC(C2)C1 |
| InChI | InChI=1S/2C10H19N.2CH4/c1-8(2)11-6-9-3-4-10(5-9)7-11;1-8(2)11-9-4-3-5-10(11)7-6-9;;/h2*8-10H,3-7H2,1-2H3;2*1H4 |
| InChIKey | JJFLCGBCEIOJGJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |