C12H9F8NO4S — CID 15893301
1,1,2,2-tetrafluoro-N-phenacyl-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide (PubChem CID 15893301) has the molecular formula C12H9F8NO4S and a molecular weight of 415.26 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-N-phenacyl-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide.
| Compound Name | 1,1,2,2-tetrafluoro-N-phenacyl-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 15893301 |
| Molecular Formula | C12H9F8NO4S |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 1,1,2,2-tetrafluoro-N-phenacyl-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide |
| SMILES | O=C(CNS(=O)(=O)C(F)(F)C(F)(F)OC(F)(F)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H9F8NO4S/c13-9(14)10(15,16)25-11(17,18)12(19,20)26(23,24)21-6-8(22)7-4-2-1-3-5-7/h1-5,9,21H,6H2 |
| InChIKey | ISKUFNJSAAMBIY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|