About 5,5-dimethyl-2,4-dioxohexanamide
5,5-dimethyl-2,4-dioxohexanamide (PubChem CID 15893330) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 5,5-dimethyl-2,4-dioxohexanamide.
Molecular Properties
| Compound Name | 5,5-dimethyl-2,4-dioxohexanamide |
| PubChem CID | 15893330 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 5,5-dimethyl-2,4-dioxohexanamide |
| SMILES | CC(C)(C)C(=O)CC(=O)C(N)=O |
| InChI | InChI=1S/C8H13NO3/c1-8(2,3)6(11)4-5(10)7(9)12/h4H2,1-3H3,(H2,9,12) |
| InChIKey | ZXAISJLUGSVVIA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-2,4-dioxohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2,4-dioxohexanamide?
The IUPAC name of 5,5-dimethyl-2,4-dioxohexanamide (CID 15893330) is 5,5-dimethyl-2,4-dioxohexanamide.
What is the SMILES notation for 5,5-dimethyl-2,4-dioxohexanamide?
The canonical SMILES for 5,5-dimethyl-2,4-dioxohexanamide is CC(C)(C)C(=O)CC(=O)C(N)=O.
What is the InChIKey of 5,5-dimethyl-2,4-dioxohexanamide?
The InChIKey is ZXAISJLUGSVVIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-8(2,3)6(11)4-5(10)7(9)12/h4H2,1-3H3,(H2,9,12).
What are the key properties of 5,5-dimethyl-2,4-dioxohexanamide?
5,5-dimethyl-2,4-dioxohexanamide has a molecular weight of 171.20 g/mol, XLogP of 0.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2,4-dioxohexanamide is sourced from PubChem (CID 15893330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).