C44H40ClF3N6O3 — CID 158934262
bis(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone;(5-chloro-1H-indol-2-yl)-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methanone (PubChem CID 158934262) has the molecular formula C44H40ClF3N6O3 and a molecular weight of 793.29 g/mol. Its IUPAC name is bis(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone;(5-chloro-1H-indol-2-yl)-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methanone.
| Compound Name | bis(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone;(5-chloro-1H-indol-2-yl)-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 158934262 |
| Molecular Formula | C44H40ClF3N6O3 |
| Molecular Weight | 793.29 g/mol |
| Exact Mass | 792.28 |
| IUPAC Name | bis(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone;(5-chloro-1H-indol-2-yl)-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methanone |
| SMILES | O=C(N1CCc2[nH]c3ccccc3c2C1)N1CCc2[nH]c3ccccc3c2C1.O=C(c1cc2cc(Cl)ccc2[nH]1)N1CCC(Oc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C23H22N4O.C21H18ClF3N2O2/c28-23(26-11-9-21-17(13-26)15-5-1-3-7-19(15)24-21)27-12-10-22-18(14-27)16-6-2-4-8-20(16)25-22;22-15-3-6-18-13(11-15)12-19(26-18)20(28)27-9-7-17(8-10-27)29-16-4-1-14(2-5-16)21(23,24)25/h1-8,24-25H,9-14H2;1-6,11-12,17,26H,7-10H2 |
| InChIKey | JJLLDURNXPEITH-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.29 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|