About 4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane
4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane (PubChem CID 158935094) has the molecular formula C21H22N4
and a molecular weight of 330.44 g/mol. Its IUPAC name is 4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane.
Molecular Properties
| Compound Name | 4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane |
| PubChem CID | 158935094 |
| Molecular Formula | C21H22N4 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane |
| SMILES | C.CN(C)c1ccc(-c2ccc3cc(-n4ccnc4)ccc3n2)cc1 |
| InChI | InChI=1S/C20H18N4.CH4/c1-23(2)17-6-3-15(4-7-17)19-9-5-16-13-18(8-10-20(16)22-19)24-12-11-21-14-24;/h3-14H,1-2H3;1H4 |
| InChIKey | JJNWMIOEXBXQSG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane?
The IUPAC name of 4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane (CID 158935094) is 4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane.
What is the SMILES notation for 4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane?
The canonical SMILES for 4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane is C.CN(C)c1ccc(-c2ccc3cc(-n4ccnc4)ccc3n2)cc1.
What is the InChIKey of 4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane?
The InChIKey is JJNWMIOEXBXQSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4.CH4/c1-23(2)17-6-3-15(4-7-17)19-9-5-16-13-18(8-10-20(16)22-19)24-12-11-21-14-24;/h3-14H,1-2H3;1H4.
What are the key properties of 4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane?
4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane has a molecular weight of 330.44 g/mol, XLogP of 4.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-imidazol-1-ylquinolin-2-yl)-N,N-dimethylaniline;methane is sourced from PubChem (CID 158935094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).