C18H42Cl2O7Si — CID 158935476
tert-butyl-[2-(2-chloroethoxy)ethoxy]-dimethylsilane;2-(2-chloroethoxy)ethanol;2-(2-hydroxyethoxy)ethanol (PubChem CID 158935476) has the molecular formula C18H42Cl2O7Si and a molecular weight of 469.52 g/mol. Its IUPAC name is tert-butyl-[2-(2-chloroethoxy)ethoxy]-dimethylsilane;2-(2-chloroethoxy)ethanol;2-(2-hydroxyethoxy)ethanol.
| Compound Name | tert-butyl-[2-(2-chloroethoxy)ethoxy]-dimethylsilane;2-(2-chloroethoxy)ethanol;2-(2-hydroxyethoxy)ethanol |
|---|---|
| PubChem CID | 158935476 |
| Molecular Formula | C18H42Cl2O7Si |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | tert-butyl-[2-(2-chloroethoxy)ethoxy]-dimethylsilane;2-(2-chloroethoxy)ethanol;2-(2-hydroxyethoxy)ethanol |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCCCl.OCCOCCCl.OCCOCCO |
| InChI | InChI=1S/C10H23ClO2Si.C4H9ClO2.C4H10O3/c1-10(2,3)14(4,5)13-9-8-12-7-6-11;2*5-1-3-7-4-2-6/h6-9H2,1-5H3;6H,1-4H2;5-6H,1-4H2 |
| InChIKey | JJOZWMQAFMWQCB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|